C23H17BrF3N3O2 — CID 135886415
3-[(3-bromo-2-hydroxyphenyl)diazenyl]-1-(3,5-dimethylphenyl)-6-(trifluoromethyl)indol-2-ol (PubChem CID 135886415) has the molecular formula C23H17BrF3N3O2 and a molecular weight of 504.31 g/mol. Its IUPAC name is 3-[(3-bromo-2-hydroxyphenyl)diazenyl]-1-(3,5-dimethylphenyl)-6-(trifluoromethyl)indol-2-ol.
| Compound Name | 3-[(3-bromo-2-hydroxyphenyl)diazenyl]-1-(3,5-dimethylphenyl)-6-(trifluoromethyl)indol-2-ol |
|---|---|
| PubChem CID | 135886415 |
| Molecular Formula | C23H17BrF3N3O2 |
| Molecular Weight | 504.31 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 3-[(3-bromo-2-hydroxyphenyl)diazenyl]-1-(3,5-dimethylphenyl)-6-(trifluoromethyl)indol-2-ol |
| SMILES | Cc1cc(C)cc(-n2c(O)c(/N=N/c3cccc(Br)c3O)c3ccc(C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C23H17BrF3N3O2/c1-12-8-13(2)10-15(9-12)30-19-11-14(23(25,26)27)6-7-16(19)20(22(30)32)29-28-18-5-3-4-17(24)21(18)31/h3-11,31-32H,1-2H3/b29-28+ |
| InChIKey | LQTRYPLLRSMTTD-ZQHSETAFSA-N |
| XLogP | 7.86 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.31 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|