C28H25F3N2O4 — CID 136595957
4-[3-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-2-hydroxyphenyl]butanoic acid (PubChem CID 136595957) has the molecular formula C28H25F3N2O4 and a molecular weight of 510.51 g/mol. Its IUPAC name is 4-[3-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-2-hydroxyphenyl]butanoic acid.
| Compound Name | 4-[3-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-2-hydroxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 136595957 |
| Molecular Formula | C28H25F3N2O4 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-[3-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-2-hydroxyphenyl]butanoic acid |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3cccc(CCCC(=O)O)c3O)c3ccc(C(F)(F)F)cc32)cc1C |
| InChI | InChI=1S/C28H25F3N2O4/c1-16-9-11-20(13-17(16)2)33-24-14-19(28(29,30)31)10-12-21(24)22(27(33)37)15-32-23-7-3-5-18(26(23)36)6-4-8-25(34)35/h3,5,7,9-15,36-37H,4,6,8H2,1-2H3,(H,34,35)/b32-15+ |
| InChIKey | MAYIZZXCIINBSF-VWJSQJICSA-N |
| XLogP | 6.84 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|