C27H27N3O4 — CID 135796772
4-[2-hydroxy-3-[[2-hydroxy-3-[2-(2-methylphenyl)ethyl]phenyl]diazenyl]indol-1-yl]butanoic acid (PubChem CID 135796772) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[[2-hydroxy-3-[2-(2-methylphenyl)ethyl]phenyl]diazenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[2-hydroxy-3-[[2-hydroxy-3-[2-(2-methylphenyl)ethyl]phenyl]diazenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 135796772 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[2-hydroxy-3-[[2-hydroxy-3-[2-(2-methylphenyl)ethyl]phenyl]diazenyl]indol-1-yl]butanoic acid |
| SMILES | Cc1ccccc1CCc1cccc(/N=N/c2c(O)n(CCCC(=O)O)c3ccccc23)c1O |
| InChI | InChI=1S/C27H27N3O4/c1-18-8-2-3-9-19(18)15-16-20-10-6-12-22(26(20)33)28-29-25-21-11-4-5-13-23(21)30(27(25)34)17-7-14-24(31)32/h2-6,8-13,33-34H,7,14-17H2,1H3,(H,31,32)/b29-28+ |
| InChIKey | UPUZLCBSOXRXAP-ZQHSETAFSA-N |
| XLogP | 6.43 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|