C19H19N3O3 — CID 135692431
4-[[2-hydroxy-1-(2-methylpropyl)indol-3-yl]diazenyl]benzoic acid (PubChem CID 135692431) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[[2-hydroxy-1-(2-methylpropyl)indol-3-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[2-hydroxy-1-(2-methylpropyl)indol-3-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 135692431 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-[[2-hydroxy-1-(2-methylpropyl)indol-3-yl]diazenyl]benzoic acid |
| SMILES | CC(C)Cn1c(O)c(/N=N/c2ccc(C(=O)O)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H19N3O3/c1-12(2)11-22-16-6-4-3-5-15(16)17(18(22)23)21-20-14-9-7-13(8-10-14)19(24)25/h3-10,12,23H,11H2,1-2H3,(H,24,25)/b21-20+ |
| InChIKey | HPWASGLSKOBCQU-QZQOTICOSA-N |
| XLogP | 5.12 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|