C18H21N5O — CID 135823984
3-[(4,6-dimethylpyrimidin-2-yl)diazenyl]-1-(2-methylpropyl)indol-2-ol (PubChem CID 135823984) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[(4,6-dimethylpyrimidin-2-yl)diazenyl]-1-(2-methylpropyl)indol-2-ol.
| Compound Name | 3-[(4,6-dimethylpyrimidin-2-yl)diazenyl]-1-(2-methylpropyl)indol-2-ol |
|---|---|
| PubChem CID | 135823984 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-[(4,6-dimethylpyrimidin-2-yl)diazenyl]-1-(2-methylpropyl)indol-2-ol |
| SMILES | Cc1cc(C)nc(/N=N/c2c(O)n(CC(C)C)c3ccccc23)n1 |
| InChI | InChI=1S/C18H21N5O/c1-11(2)10-23-15-8-6-5-7-14(15)16(17(23)24)21-22-18-19-12(3)9-13(4)20-18/h5-9,11,24H,10H2,1-4H3/b22-21+ |
| InChIKey | QMEGLXRFXKBWJT-QURGRASLSA-N |
| XLogP | 4.83 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|