C20H24N6O — CID 3554621
3-[(4,6-dimethylpyrimidin-2-yl)diazenyl]-1-(piperidin-1-ylmethyl)indol-2-ol (PubChem CID 3554621) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[(4,6-dimethylpyrimidin-2-yl)diazenyl]-1-(piperidin-1-ylmethyl)indol-2-ol.
| Compound Name | 3-[(4,6-dimethylpyrimidin-2-yl)diazenyl]-1-(piperidin-1-ylmethyl)indol-2-ol |
|---|---|
| PubChem CID | 3554621 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 3-[(4,6-dimethylpyrimidin-2-yl)diazenyl]-1-(piperidin-1-ylmethyl)indol-2-ol |
| SMILES | Cc1cc(C)nc(/N=N/c2c(O)n(CN3CCCCC3)c3ccccc23)n1 |
| InChI | InChI=1S/C20H24N6O/c1-14-12-15(2)22-20(21-14)24-23-18-16-8-4-5-9-17(16)26(19(18)27)13-25-10-6-3-7-11-25/h4-5,8-9,12,27H,3,6-7,10-11,13H2,1-2H3/b24-23+ |
| InChIKey | BIQRUSMXHKRYFJ-WCWDXBQESA-N |
| XLogP | 4.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|