C22H23N5O2 — CID 135839900
3-ethyl-2-[[2-hydroxy-1-(2-methylpropyl)indol-3-yl]diazenyl]quinazolin-4-one (PubChem CID 135839900) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-ethyl-2-[[2-hydroxy-1-(2-methylpropyl)indol-3-yl]diazenyl]quinazolin-4-one.
| Compound Name | 3-ethyl-2-[[2-hydroxy-1-(2-methylpropyl)indol-3-yl]diazenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 135839900 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 3-ethyl-2-[[2-hydroxy-1-(2-methylpropyl)indol-3-yl]diazenyl]quinazolin-4-one |
| SMILES | CCn1c(/N=N/c2c(O)n(CC(C)C)c3ccccc23)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H23N5O2/c1-4-26-20(28)15-9-5-7-11-17(15)23-22(26)25-24-19-16-10-6-8-12-18(16)27(21(19)29)13-14(2)3/h5-12,14,29H,4,13H2,1-3H3/b25-24+ |
| InChIKey | KHAXRBXWWODOGJ-OCOZRVBESA-N |
| XLogP | 5.15 |
| TPSA | 84.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|