C18H16ClN3O3 — CID 135846205
4-chloro-3-[(2-hydroxy-1-propan-2-ylindol-3-yl)diazenyl]benzoic acid (PubChem CID 135846205) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 4-chloro-3-[(2-hydroxy-1-propan-2-ylindol-3-yl)diazenyl]benzoic acid.
| Compound Name | 4-chloro-3-[(2-hydroxy-1-propan-2-ylindol-3-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 135846205 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-chloro-3-[(2-hydroxy-1-propan-2-ylindol-3-yl)diazenyl]benzoic acid |
| SMILES | CC(C)n1c(O)c(/N=N/c2cc(C(=O)O)ccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C18H16ClN3O3/c1-10(2)22-15-6-4-3-5-12(15)16(17(22)23)21-20-14-9-11(18(24)25)7-8-13(14)19/h3-10,23H,1-2H3,(H,24,25)/b21-20+ |
| InChIKey | BNIBHEDDFBJXJP-QZQOTICOSA-N |
| XLogP | 5.69 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|