C27H27N3O4 — CID 3515590
4-[(4-ethoxyphenoxy)methyl]-N-(2-hydroxy-1-propan-2-ylindol-3-yl)iminobenzamide (PubChem CID 3515590) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-[(4-ethoxyphenoxy)methyl]-N-(2-hydroxy-1-propan-2-ylindol-3-yl)iminobenzamide.
| Compound Name | 4-[(4-ethoxyphenoxy)methyl]-N-(2-hydroxy-1-propan-2-ylindol-3-yl)iminobenzamide |
|---|---|
| PubChem CID | 3515590 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[(4-ethoxyphenoxy)methyl]-N-(2-hydroxy-1-propan-2-ylindol-3-yl)iminobenzamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)/N=N/c3c(O)n(C(C)C)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-4-33-21-13-15-22(16-14-21)34-17-19-9-11-20(12-10-19)26(31)29-28-25-23-7-5-6-8-24(23)30(18(2)3)27(25)32/h5-16,18,32H,4,17H2,1-3H3/b29-28+ |
| InChIKey | RAALDTVPCROOJB-ZQHSETAFSA-N |
| XLogP | 6.83 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|