C28H28ClN5O3 — CID 135617053
4-[(3-chlorophenyl)methoxy]-N-[2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]iminobenzamide (PubChem CID 135617053) has the molecular formula C28H28ClN5O3 and a molecular weight of 518.02 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methoxy]-N-[2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]iminobenzamide.
| Compound Name | 4-[(3-chlorophenyl)methoxy]-N-[2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]iminobenzamide |
|---|---|
| PubChem CID | 135617053 |
| Molecular Formula | C28H28ClN5O3 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 4-[(3-chlorophenyl)methoxy]-N-[2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]iminobenzamide |
| SMILES | CN1CCN(Cn2c(O)c(/N=N/C(=O)c3ccc(OCc4cccc(Cl)c4)cc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C28H28ClN5O3/c1-32-13-15-33(16-14-32)19-34-25-8-3-2-7-24(25)26(28(34)36)30-31-27(35)21-9-11-23(12-10-21)37-18-20-5-4-6-22(29)17-20/h2-12,17,36H,13-16,18-19H2,1H3/b31-30+ |
| InChIKey | XFWUHLMMNKVCJB-NVQSTNCTSA-N |
| XLogP | 5.71 |
| TPSA | 82.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|