C28H26Cl2N4O3 — CID 135888988
N-[4-chloro-2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]imino-4-[(2-chlorophenyl)methoxy]benzamide (PubChem CID 135888988) has the molecular formula C28H26Cl2N4O3 and a molecular weight of 537.45 g/mol. Its IUPAC name is N-[4-chloro-2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]imino-4-[(2-chlorophenyl)methoxy]benzamide.
| Compound Name | N-[4-chloro-2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]imino-4-[(2-chlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 135888988 |
| Molecular Formula | C28H26Cl2N4O3 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-[4-chloro-2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]imino-4-[(2-chlorophenyl)methoxy]benzamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2CCCCC2)c2cccc(Cl)c12)c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C28H26Cl2N4O3/c29-22-8-3-2-7-20(22)17-37-21-13-11-19(12-14-21)27(35)32-31-26-25-23(30)9-6-10-24(25)34(28(26)36)18-33-15-4-1-5-16-33/h2-3,6-14,36H,1,4-5,15-18H2/b32-31+ |
| InChIKey | IDQBMSQAMHLFMK-QNEJGDQOSA-N |
| XLogP | 7.60 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|