C27H24Cl2N4O3 — CID 135888990
N-[4-chloro-2-hydroxy-1-(pyrrolidin-1-ylmethyl)indol-3-yl]imino-4-[(2-chlorophenyl)methoxy]benzamide (PubChem CID 135888990) has the molecular formula C27H24Cl2N4O3 and a molecular weight of 523.42 g/mol. Its IUPAC name is N-[4-chloro-2-hydroxy-1-(pyrrolidin-1-ylmethyl)indol-3-yl]imino-4-[(2-chlorophenyl)methoxy]benzamide.
| Compound Name | N-[4-chloro-2-hydroxy-1-(pyrrolidin-1-ylmethyl)indol-3-yl]imino-4-[(2-chlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 135888990 |
| Molecular Formula | C27H24Cl2N4O3 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | N-[4-chloro-2-hydroxy-1-(pyrrolidin-1-ylmethyl)indol-3-yl]imino-4-[(2-chlorophenyl)methoxy]benzamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2CCCC2)c2cccc(Cl)c12)c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H24Cl2N4O3/c28-21-7-2-1-6-19(21)16-36-20-12-10-18(11-13-20)26(34)31-30-25-24-22(29)8-5-9-23(24)33(27(25)35)17-32-14-3-4-15-32/h1-2,5-13,35H,3-4,14-17H2/b31-30+ |
| InChIKey | RSLYGTUYEPHNOI-NVQSTNCTSA-N |
| XLogP | 7.21 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|