C23H21N3O4 — CID 135725844
N-(2-hydroxy-1-propan-2-ylindol-3-yl)imino-5-(phenoxymethyl)furan-2-carboxamide (PubChem CID 135725844) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-(2-hydroxy-1-propan-2-ylindol-3-yl)imino-5-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-(2-hydroxy-1-propan-2-ylindol-3-yl)imino-5-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 135725844 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-(2-hydroxy-1-propan-2-ylindol-3-yl)imino-5-(phenoxymethyl)furan-2-carboxamide |
| SMILES | CC(C)n1c(O)c(/N=N/C(=O)c2ccc(COc3ccccc3)o2)c2ccccc21 |
| InChI | InChI=1S/C23H21N3O4/c1-15(2)26-19-11-7-6-10-18(19)21(23(26)28)24-25-22(27)20-13-12-17(30-20)14-29-16-8-4-3-5-9-16/h3-13,15,28H,14H2,1-2H3/b25-24+ |
| InChIKey | DJCFKZGETPAPRX-OCOZRVBESA-N |
| XLogP | 6.02 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|