C18H20N4O2 — CID 135620100
N-(2-hydroxy-1-propan-2-ylindol-3-yl)imino-2-(1-methylpyrrol-2-yl)acetamide (PubChem CID 135620100) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(2-hydroxy-1-propan-2-ylindol-3-yl)imino-2-(1-methylpyrrol-2-yl)acetamide.
| Compound Name | N-(2-hydroxy-1-propan-2-ylindol-3-yl)imino-2-(1-methylpyrrol-2-yl)acetamide |
|---|---|
| PubChem CID | 135620100 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-(2-hydroxy-1-propan-2-ylindol-3-yl)imino-2-(1-methylpyrrol-2-yl)acetamide |
| SMILES | CC(C)n1c(O)c(/N=N/C(=O)Cc2cccn2C)c2ccccc21 |
| InChI | InChI=1S/C18H20N4O2/c1-12(2)22-15-9-5-4-8-14(15)17(18(22)24)20-19-16(23)11-13-7-6-10-21(13)3/h4-10,12,24H,11H2,1-3H3/b20-19+ |
| InChIKey | YIBCXEHIOLVVBO-FMQUCBEESA-N |
| XLogP | 4.12 |
| TPSA | 71.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|