C23H29N3O2 — CID 135775403
2-(1-adamantyl)-N-(2-hydroxy-1-propan-2-ylindol-3-yl)iminoacetamide (PubChem CID 135775403) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2-hydroxy-1-propan-2-ylindol-3-yl)iminoacetamide.
| Compound Name | 2-(1-adamantyl)-N-(2-hydroxy-1-propan-2-ylindol-3-yl)iminoacetamide |
|---|---|
| PubChem CID | 135775403 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-(1-adamantyl)-N-(2-hydroxy-1-propan-2-ylindol-3-yl)iminoacetamide |
| SMILES | CC(C)n1c(O)c(/N=N/C(=O)CC23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| InChI | InChI=1S/C23H29N3O2/c1-14(2)26-19-6-4-3-5-18(19)21(22(26)28)25-24-20(27)13-23-10-15-7-16(11-23)9-17(8-15)12-23/h3-6,14-17,28H,7-13H2,1-2H3/b25-24+ |
| InChIKey | HMFVOFVULIUSFY-OCOZRVBESA-N |
| XLogP | 6.14 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|