C41H49N5O2 — CID 132533365
4-[(6-amino-5,11-dioctylindolo[3,2-b]carbazol-12-yl)diazenyl]benzoic acid (PubChem CID 132533365) has the molecular formula C41H49N5O2 and a molecular weight of 643.88 g/mol. Its IUPAC name is 4-[(6-amino-5,11-dioctylindolo[3,2-b]carbazol-12-yl)diazenyl]benzoic acid.
| Compound Name | 4-[(6-amino-5,11-dioctylindolo[3,2-b]carbazol-12-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 132533365 |
| Molecular Formula | C41H49N5O2 |
| Molecular Weight | 643.88 g/mol |
| Exact Mass | 643.39 |
| IUPAC Name | 4-[(6-amino-5,11-dioctylindolo[3,2-b]carbazol-12-yl)diazenyl]benzoic acid |
| SMILES | CCCCCCCCn1c2ccccc2c2c(/N=N/c3ccc(C(=O)O)cc3)c3c(c(N)c21)c1ccccc1n3CCCCCCCC |
| InChI | InChI=1S/C41H49N5O2/c1-3-5-7-9-11-17-27-45-34-22-16-14-20-32(34)36-38(44-43-30-25-23-29(24-26-30)41(47)48)40-35(37(42)39(36)45)31-19-13-15-21-33(31)46(40)28-18-12-10-8-6-4-2/h13-16,19-26H,3-12,17-18,27-28,42H2,1-2H3,(H,47,48)/b44-43+ |
| InChIKey | XYQDDNJLGNEDQG-VGFSZAGXSA-N |
| XLogP | 12.32 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.88 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|