C27H29N3O2 — CID 136596075
1-butyl-3-[[2-hydroxy-3-[2-(2-methylphenyl)ethyl]phenyl]diazenyl]indol-2-ol (PubChem CID 136596075) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-butyl-3-[[2-hydroxy-3-[2-(2-methylphenyl)ethyl]phenyl]diazenyl]indol-2-ol.
| Compound Name | 1-butyl-3-[[2-hydroxy-3-[2-(2-methylphenyl)ethyl]phenyl]diazenyl]indol-2-ol |
|---|---|
| PubChem CID | 136596075 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 1-butyl-3-[[2-hydroxy-3-[2-(2-methylphenyl)ethyl]phenyl]diazenyl]indol-2-ol |
| SMILES | CCCCn1c(O)c(/N=N/c2cccc(CCc3ccccc3C)c2O)c2ccccc21 |
| InChI | InChI=1S/C27H29N3O2/c1-3-4-18-30-24-15-8-7-13-22(24)25(27(30)32)29-28-23-14-9-12-21(26(23)31)17-16-20-11-6-5-10-19(20)2/h5-15,31-32H,3-4,16-18H2,1-2H3/b29-28+ |
| InChIKey | JIWGTEFCPYNFHW-ZQHSETAFSA-N |
| XLogP | 7.36 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|