C26H25N3O4 — CID 135796818
4-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]butanoic acid (PubChem CID 135796818) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]butanoic acid.
| Compound Name | 4-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 135796818 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]butanoic acid |
| SMILES | Cc1cc(C)cc(-c2cccc(/N=N/c3c(O)n(CCCC(=O)O)c4ccccc34)c2O)c1 |
| InChI | InChI=1S/C26H25N3O4/c1-16-13-17(2)15-18(14-16)19-8-5-9-21(25(19)32)27-28-24-20-7-3-4-10-22(20)29(26(24)33)12-6-11-23(30)31/h3-5,7-10,13-15,32-33H,6,11-12H2,1-2H3,(H,30,31)/b28-27+ |
| InChIKey | PUMVYUKWZCLWNS-BYYHNAKLSA-N |
| XLogP | 6.62 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|