About 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid
2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid (PubChem CID 135796773) has the molecular formula C24H21N3O4
and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid |
| PubChem CID | 135796773 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid |
| SMILES | Cc1cc(C)cc(-c2cccc(/N=N/c3c(O)n(CC(=O)O)c4ccccc34)c2O)c1 |
| InChI | InChI=1S/C24H21N3O4/c1-14-10-15(2)12-16(11-14)17-7-5-8-19(23(17)30)25-26-22-18-6-3-4-9-20(18)27(24(22)31)13-21(28)29/h3-12,30-31H,13H2,1-2H3,(H,28,29)/b26-25+ |
| InChIKey | AGELGKYFTGJWCA-OCEACIFDSA-N |
| XLogP | 5.84 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid?
The IUPAC name of 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid (CID 135796773) is 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid.
What is the SMILES notation for 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid?
The canonical SMILES for 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid is Cc1cc(C)cc(-c2cccc(/N=N/c3c(O)n(CC(=O)O)c4ccccc34)c2O)c1.
What is the InChIKey of 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid?
The InChIKey is AGELGKYFTGJWCA-OCEACIFDSA-N. The full InChI is InChI=1S/C24H21N3O4/c1-14-10-15(2)12-16(11-14)17-7-5-8-19(23(17)30)25-26-22-18-6-3-4-9-20(18)27(24(22)31)13-21(28)29/h3-12,30-31H,13H2,1-2H3,(H,28,29)/b26-25+.
What are the key properties of 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid?
2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid has a molecular weight of 415.45 g/mol, XLogP of 5.84, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid is sourced from PubChem (CID 135796773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).