C24H21N3O4 — CID 135796773
2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid (PubChem CID 135796773) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid.
| Compound Name | 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 135796773 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[3-[[3-(3,5-dimethylphenyl)-2-hydroxyphenyl]diazenyl]-2-hydroxyindol-1-yl]acetic acid |
| SMILES | Cc1cc(C)cc(-c2cccc(/N=N/c3c(O)n(CC(=O)O)c4ccccc34)c2O)c1 |
| InChI | InChI=1S/C24H21N3O4/c1-14-10-15(2)12-16(11-14)17-7-5-8-19(23(17)30)25-26-22-18-6-3-4-9-20(18)27(24(22)31)13-21(28)29/h3-12,30-31H,13H2,1-2H3,(H,28,29)/b26-25+ |
| InChIKey | AGELGKYFTGJWCA-OCEACIFDSA-N |
| XLogP | 5.84 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|