C27H20ClF3N2O4 — CID 142696019
2-chloro-3-[4-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-3-hydroxyphenyl]prop-2-enoic acid (PubChem CID 142696019) has the molecular formula C27H20ClF3N2O4 and a molecular weight of 528.91 g/mol. Its IUPAC name is 2-chloro-3-[4-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-3-hydroxyphenyl]prop-2-enoic acid.
| Compound Name | 2-chloro-3-[4-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-3-hydroxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142696019 |
| Molecular Formula | C27H20ClF3N2O4 |
| Molecular Weight | 528.91 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 2-chloro-3-[4-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-3-hydroxyphenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3ccc(C=C(Cl)C(=O)O)cc3O)c3ccc(C(F)(F)F)cc32)cc1C |
| InChI | InChI=1S/C27H20ClF3N2O4/c1-14-3-6-18(9-15(14)2)33-23-12-17(27(29,30)31)5-7-19(23)20(25(33)35)13-32-22-8-4-16(11-24(22)34)10-21(28)26(36)37/h3-13,34-35H,1-2H3,(H,36,37)/b21-10?,32-13+ |
| InChIKey | FCBBQBNGXMMDED-QKEPSRAZSA-N |
| XLogP | 7.09 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.91 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|