C27H18F4N4O3S2 — CID 135461393
(5Z)-5-[[4-[[1-(3,4-dimethylphenyl)-4-fluoro-2-hydroxy-6-(trifluoromethyl)indol-3-yl]diazenyl]-3-hydroxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 135461393) has the molecular formula C27H18F4N4O3S2 and a molecular weight of 586.59 g/mol. Its IUPAC name is (5Z)-5-[[4-[[1-(3,4-dimethylphenyl)-4-fluoro-2-hydroxy-6-(trifluoromethyl)indol-3-yl]diazenyl]-3-hydroxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[[1-(3,4-dimethylphenyl)-4-fluoro-2-hydroxy-6-(trifluoromethyl)indol-3-yl]diazenyl]-3-hydroxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135461393 |
| Molecular Formula | C27H18F4N4O3S2 |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | (5Z)-5-[[4-[[1-(3,4-dimethylphenyl)-4-fluoro-2-hydroxy-6-(trifluoromethyl)indol-3-yl]diazenyl]-3-hydroxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(-n2c(O)c(/N=N/c3ccc(/C=C4\SC(=S)NC4=O)cc3O)c3c(F)cc(C(F)(F)F)cc32)cc1C |
| InChI | InChI=1S/C27H18F4N4O3S2/c1-12-3-5-16(7-13(12)2)35-19-11-15(27(29,30)31)10-17(28)22(19)23(25(35)38)34-33-18-6-4-14(8-20(18)36)9-21-24(37)32-26(39)40-21/h3-11,36,38H,1-2H3,(H,32,37,39)/b21-9-,34-33+ |
| InChIKey | NCJFWGSTSUVUSV-SNUBVKAISA-N |
| XLogP | 7.72 |
| TPSA | 99.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|