C20H21N5O4S — CID 135474669
(5Z)-5-[[4-[(2-cyclohexyl-5-methyl-3-oxo-1H-pyrazol-4-yl)diazenyl]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 135474669) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2-cyclohexyl-5-methyl-3-oxo-1H-pyrazol-4-yl)diazenyl]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(2-cyclohexyl-5-methyl-3-oxo-1H-pyrazol-4-yl)diazenyl]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 135474669 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (5Z)-5-[[4-[(2-cyclohexyl-5-methyl-3-oxo-1H-pyrazol-4-yl)diazenyl]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1[nH]n(C2CCCCC2)c(=O)c1/N=N/c1ccc(/C=C2\SC(=O)NC2=O)cc1O |
| InChI | InChI=1S/C20H21N5O4S/c1-11-17(19(28)25(24-11)13-5-3-2-4-6-13)23-22-14-8-7-12(9-15(14)26)10-16-18(27)21-20(29)30-16/h7-10,13,24,26H,2-6H2,1H3,(H,21,27,29)/b16-10-,23-22+ |
| InChIKey | GCOWZDRKVRABPL-JIUMWLTHSA-N |
| XLogP | 4.43 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|