C21H16N2O4S4 — CID 159654137
(5Z)-5-[(4-hydroxy-3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;(5Z)-5-[(4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 159654137) has the molecular formula C21H16N2O4S4 and a molecular weight of 488.64 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxy-3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;(5Z)-5-[(4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-hydroxy-3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;(5Z)-5-[(4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 159654137 |
| Molecular Formula | C21H16N2O4S4 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | (5Z)-5-[(4-hydroxy-3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;(5Z)-5-[(4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2\SC(=S)NC2=O)ccc1O.O=C1NC(=S)S/C1=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C11H9NO2S2.C10H7NO2S2/c1-6-4-7(2-3-8(6)13)5-9-10(14)12-11(15)16-9;12-7-3-1-6(2-4-7)5-8-9(13)11-10(14)15-8/h2-5,13H,1H3,(H,12,14,15);1-5,12H,(H,11,13,14)/b9-5-;8-5- |
| InChIKey | MRYPOYMWXNRBBD-GAPZEALQSA-N |
| XLogP | 4.07 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|