C10H7NO5S3 — CID 5478205
2-hydroxy-5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzenesulfonic acid (PubChem CID 5478205) has the molecular formula C10H7NO5S3 and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-hydroxy-5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzenesulfonic acid.
| Compound Name | 2-hydroxy-5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 5478205 |
| Molecular Formula | C10H7NO5S3 |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 2-hydroxy-5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzenesulfonic acid |
| SMILES | O=C1NC(=S)S/C1=C/c1ccc(O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H7NO5S3/c12-6-2-1-5(4-8(6)19(14,15)16)3-7-9(13)11-10(17)18-7/h1-4,12H,(H,11,13,17)(H,14,15,16)/b7-3+ |
| InChIKey | IAHXBIJYDBIIJU-XVNBXDOJSA-N |
| XLogP | 1.13 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|