C30H25N3O4 — CID 136651662
2-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-methylindol-3-yl]diazenyl]-3-(2-hydroxyphenyl)benzoic acid (PubChem CID 136651662) has the molecular formula C30H25N3O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-methylindol-3-yl]diazenyl]-3-(2-hydroxyphenyl)benzoic acid.
| Compound Name | 2-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-methylindol-3-yl]diazenyl]-3-(2-hydroxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 136651662 |
| Molecular Formula | C30H25N3O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 2-[[1-(3,4-dimethylphenyl)-2-hydroxy-6-methylindol-3-yl]diazenyl]-3-(2-hydroxyphenyl)benzoic acid |
| SMILES | Cc1ccc2c(/N=N/c3c(C(=O)O)cccc3-c3ccccc3O)c(O)n(-c3ccc(C)c(C)c3)c2c1 |
| InChI | InChI=1S/C30H25N3O4/c1-17-11-14-23-25(15-17)33(20-13-12-18(2)19(3)16-20)29(35)28(23)32-31-27-22(8-6-9-24(27)30(36)37)21-7-4-5-10-26(21)34/h4-16,34-35H,1-3H3,(H,36,37)/b32-31+ |
| InChIKey | AWWANLMIWIDSTK-QNEJGDQOSA-N |
| XLogP | 7.75 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|