C31H27N3O4 — CID 136500219
2-[[2-hydroxy-5-methyl-1-(4-propan-2-ylphenyl)indol-3-yl]diazenyl]-3-(2-hydroxyphenyl)benzoic acid (PubChem CID 136500219) has the molecular formula C31H27N3O4 and a molecular weight of 505.57 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-methyl-1-(4-propan-2-ylphenyl)indol-3-yl]diazenyl]-3-(2-hydroxyphenyl)benzoic acid.
| Compound Name | 2-[[2-hydroxy-5-methyl-1-(4-propan-2-ylphenyl)indol-3-yl]diazenyl]-3-(2-hydroxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 136500219 |
| Molecular Formula | C31H27N3O4 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[[2-hydroxy-5-methyl-1-(4-propan-2-ylphenyl)indol-3-yl]diazenyl]-3-(2-hydroxyphenyl)benzoic acid |
| SMILES | Cc1ccc2c(c1)c(/N=N/c1c(C(=O)O)cccc1-c1ccccc1O)c(O)n2-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C31H27N3O4/c1-18(2)20-12-14-21(15-13-20)34-26-16-11-19(3)17-25(26)29(30(34)36)33-32-28-23(8-6-9-24(28)31(37)38)22-7-4-5-10-27(22)35/h4-18,35-36H,1-3H3,(H,37,38)/b33-32+ |
| InChIKey | VLAQDDYMTPACFX-ULIFNZDWSA-N |
| XLogP | 8.25 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|