2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid

C18H15NO3 — CID 126617950

IUPAC2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid
SMILESCc1ccc2c(c1)c(=O)c(C(=O)O)c(C)n2-c1ccccc1
InChIInChI=1S/C18H15NO3/c1-11-8-9-15-14(10-11)17(20)16(18(21)22)12(2)19(15)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,21,22)
InChIKeyYBYHYAJLRZVAOU-UHFFFAOYSA-N
MW293.32 g/mol
LogP3.31
Rot. Bonds2

About 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid

2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid (PubChem CID 126617950) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid.

Molecular Properties

Compound Name2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid
PubChem CID126617950
Molecular FormulaC18H15NO3
Molecular Weight293.32 g/mol
Exact Mass293.11
IUPAC Name2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid
SMILESCc1ccc2c(c1)c(=O)c(C(=O)O)c(C)n2-c1ccccc1
InChIInChI=1S/C18H15NO3/c1-11-8-9-15-14(10-11)17(20)16(18(21)22)12(2)19(15)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,21,22)
InChIKeyYBYHYAJLRZVAOU-UHFFFAOYSA-N
XLogP3.31
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.32
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid?
The IUPAC name of 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid (CID 126617950) is 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid.
What is the SMILES notation for 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid?
The canonical SMILES for 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid is Cc1ccc2c(c1)c(=O)c(C(=O)O)c(C)n2-c1ccccc1.
What is the InChIKey of 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid?
The InChIKey is YBYHYAJLRZVAOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO3/c1-11-8-9-15-14(10-11)17(20)16(18(21)22)12(2)19(15)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,21,22).
What are the key properties of 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid?
2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid has a molecular weight of 293.32 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-oxo-1-phenylquinoline-3-carboxylic acid is sourced from PubChem (CID 126617950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).