C23H25N3O4 — CID 136596057
4-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-hydroxyphenyl]butanoic acid (PubChem CID 136596057) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-hydroxyphenyl]butanoic acid.
| Compound Name | 4-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-hydroxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 136596057 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-hydroxyphenyl]butanoic acid |
| SMILES | Cc1ccc(-n2[nH]c(C)c(/C=N/c3cccc(CCCC(=O)O)c3O)c2=O)cc1C |
| InChI | InChI=1S/C23H25N3O4/c1-14-10-11-18(12-15(14)2)26-23(30)19(16(3)25-26)13-24-20-8-4-6-17(22(20)29)7-5-9-21(27)28/h4,6,8,10-13,25,29H,5,7,9H2,1-3H3,(H,27,28)/b24-13+ |
| InChIKey | WTXYBNZDABNFAE-ZMOGYAJESA-N |
| XLogP | 3.95 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|