C24H30N4O2 — CID 136854041
N-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]adamantane-1-carboxamide (PubChem CID 136854041) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]adamantane-1-carboxamide.
| Compound Name | N-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 136854041 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]adamantane-1-carboxamide |
| SMILES | Cc1ccc(-n2[nH]c(C)c(C=NNC(=O)C34CC5CC(CC(C5)C3)C4)c2=O)cc1C |
| InChI | InChI=1S/C24H30N4O2/c1-14-4-5-20(6-15(14)2)28-22(29)21(16(3)27-28)13-25-26-23(30)24-10-17-7-18(11-24)9-19(8-17)12-24/h4-6,13,17-19,27H,7-12H2,1-3H3,(H,26,30) |
| InChIKey | NOULVFNXZLSGMX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|