C29H30ClN3O3 — CID 137074562
methyl 5-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-chlorobenzoate (PubChem CID 137074562) has the molecular formula C29H30ClN3O3 and a molecular weight of 504.03 g/mol. Its IUPAC name is methyl 5-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-chlorobenzoate.
| Compound Name | methyl 5-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 137074562 |
| Molecular Formula | C29H30ClN3O3 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | methyl 5-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(/N=C/c2c(C)[nH]n(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)c2=O)ccc1Cl |
| InChI | InChI=1S/C29H30ClN3O3/c1-17-25(16-31-22-5-8-26(30)24(12-22)28(35)36-2)27(34)33(32-17)23-6-3-21(4-7-23)29-13-18-9-19(14-29)11-20(10-18)15-29/h3-8,12,16,18-20,32H,9-11,13-15H2,1-2H3/b31-16+ |
| InChIKey | RGJUWUPODKRXAK-WCMJOSRZSA-N |
| XLogP | 6.13 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|