C19H17Cl2N3O2 — CID 137075332
4-[(3-chloro-4-methoxyphenyl)iminomethyl]-2-(3-chloro-4-methylphenyl)-5-methyl-1H-pyrazol-3-one (PubChem CID 137075332) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)iminomethyl]-2-(3-chloro-4-methylphenyl)-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)iminomethyl]-2-(3-chloro-4-methylphenyl)-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137075332 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)iminomethyl]-2-(3-chloro-4-methylphenyl)-5-methyl-1H-pyrazol-3-one |
| SMILES | COc1ccc(/N=C/c2c(C)[nH]n(-c3ccc(C)c(Cl)c3)c2=O)cc1Cl |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-11-4-6-14(9-16(11)20)24-19(25)15(12(2)23-24)10-22-13-5-7-18(26-3)17(21)8-13/h4-10,23H,1-3H3/b22-10+ |
| InChIKey | QSOLKQBCUSHXOE-LSHDLFTRSA-N |
| XLogP | 4.85 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|