C19H13Cl3N4O2S — CID 137069880
[2,3-dichloro-4-[[2-(4-chloro-3-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate (PubChem CID 137069880) has the molecular formula C19H13Cl3N4O2S and a molecular weight of 467.77 g/mol. Its IUPAC name is [2,3-dichloro-4-[[2-(4-chloro-3-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate.
| Compound Name | [2,3-dichloro-4-[[2-(4-chloro-3-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 137069880 |
| Molecular Formula | C19H13Cl3N4O2S |
| Molecular Weight | 467.77 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | [2,3-dichloro-4-[[2-(4-chloro-3-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate |
| SMILES | COc1cc(-n2[nH]c(C)c(/C=N/c3ccc(SC#N)c(Cl)c3Cl)c2=O)ccc1Cl |
| InChI | InChI=1S/C19H13Cl3N4O2S/c1-10-12(8-24-14-5-6-16(29-9-23)18(22)17(14)21)19(27)26(25-10)11-3-4-13(20)15(7-11)28-2/h3-8,25H,1-2H3/b24-8+ |
| InChIKey | NBMAMORACLWWKG-KTZMUZOWSA-N |
| XLogP | 5.77 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|