C21H19ClN6O5 — CID 137073540
5-[[2-(4-chloro-3-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-1,3-dimethyl-6-nitrobenzimidazol-2-one (PubChem CID 137073540) has the molecular formula C21H19ClN6O5 and a molecular weight of 470.87 g/mol. Its IUPAC name is 5-[[2-(4-chloro-3-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-1,3-dimethyl-6-nitrobenzimidazol-2-one.
| Compound Name | 5-[[2-(4-chloro-3-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-1,3-dimethyl-6-nitrobenzimidazol-2-one |
|---|---|
| PubChem CID | 137073540 |
| Molecular Formula | C21H19ClN6O5 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 5-[[2-(4-chloro-3-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-1,3-dimethyl-6-nitrobenzimidazol-2-one |
| SMILES | COc1cc(-n2[nH]c(C)c(/C=N/c3cc4c(cc3[N+](=O)[O-])n(C)c(=O)n4C)c2=O)ccc1Cl |
| InChI | InChI=1S/C21H19ClN6O5/c1-11-13(20(29)27(24-11)12-5-6-14(22)19(7-12)33-4)10-23-15-8-17-18(9-16(15)28(31)32)26(3)21(30)25(17)2/h5-10,24H,1-4H3/b23-10+ |
| InChIKey | CRIXRSCSMVUBMY-AUEPDCJTSA-N |
| XLogP | 2.99 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|