C18H14IN3O4 — CID 135699752
2-hydroxy-4-[[2-(4-iodophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzoic acid (PubChem CID 135699752) has the molecular formula C18H14IN3O4 and a molecular weight of 463.23 g/mol. Its IUPAC name is 2-hydroxy-4-[[2-(4-iodophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[2-(4-iodophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 135699752 |
| Molecular Formula | C18H14IN3O4 |
| Molecular Weight | 463.23 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 2-hydroxy-4-[[2-(4-iodophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzoic acid |
| SMILES | Cc1[nH]n(-c2ccc(I)cc2)c(=O)c1/C=N/c1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C18H14IN3O4/c1-10-15(9-20-12-4-7-14(18(25)26)16(23)8-12)17(24)22(21-10)13-5-2-11(19)3-6-13/h2-9,21,23H,1H3,(H,25,26)/b20-9+ |
| InChIKey | HBAQDQARLDZLHL-AWQFTUOYSA-N |
| XLogP | 3.23 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|