C29H32N4OS — CID 137070418
1-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-3-benzylthiourea (PubChem CID 137070418) has the molecular formula C29H32N4OS and a molecular weight of 484.67 g/mol. Its IUPAC name is 1-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-3-benzylthiourea.
| Compound Name | 1-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-3-benzylthiourea |
|---|---|
| PubChem CID | 137070418 |
| Molecular Formula | C29H32N4OS |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 1-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-3-benzylthiourea |
| SMILES | Cc1[nH]n(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c(=O)c1C=NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C29H32N4OS/c1-19-26(18-31-28(35)30-17-20-5-3-2-4-6-20)27(34)33(32-19)25-9-7-24(8-10-25)29-14-21-11-22(15-29)13-23(12-21)16-29/h2-10,18,21-23,32H,11-17H2,1H3,(H,30,35) |
| InChIKey | UGCABHLNKWQJFH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|