C37H36N4O4 — CID 137075183
2-[[5-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-methoxyphenyl]methyl]isoindole-1,3-dione (PubChem CID 137075183) has the molecular formula C37H36N4O4 and a molecular weight of 600.72 g/mol. Its IUPAC name is 2-[[5-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-methoxyphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-methoxyphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137075183 |
| Molecular Formula | C37H36N4O4 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 2-[[5-[[2-[4-(1-adamantyl)phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-2-methoxyphenyl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(/N=C/c2c(C)[nH]n(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)c2=O)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H36N4O4/c1-22-32(20-38-28-9-12-33(45-2)26(16-28)21-40-34(42)30-5-3-4-6-31(30)35(40)43)36(44)41(39-22)29-10-7-27(8-11-29)37-17-23-13-24(18-37)15-25(14-23)19-37/h3-12,16,20,23-25,39H,13-15,17-19,21H2,1-2H3/b38-20+ |
| InChIKey | GTQSZSJOIBMDKB-CHSHITCJSA-N |
| XLogP | 6.50 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|