C25H29NO2 — CID 3584287
N-[4-(1-adamantyl)phenyl]-1-(2,5-dimethoxyphenyl)methanimine (PubChem CID 3584287) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-1-(2,5-dimethoxyphenyl)methanimine.
| Compound Name | N-[4-(1-adamantyl)phenyl]-1-(2,5-dimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 3584287 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-1-(2,5-dimethoxyphenyl)methanimine |
| SMILES | COc1ccc(OC)c(/C=N/c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C25H29NO2/c1-27-23-7-8-24(28-2)20(12-23)16-26-22-5-3-21(4-6-22)25-13-17-9-18(14-25)11-19(10-17)15-25/h3-8,12,16-19H,9-11,13-15H2,1-2H3/b26-16+ |
| InChIKey | BGEQJYJDTSKNSI-WGOQTCKBSA-N |
| XLogP | 5.92 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|