C25H32N2 — CID 126103156
N-[4-(1-adamantyl)phenyl]-1-(1-ethyl-2,5-dimethylpyrrol-3-yl)methanimine (PubChem CID 126103156) has the molecular formula C25H32N2 and a molecular weight of 360.55 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-1-(1-ethyl-2,5-dimethylpyrrol-3-yl)methanimine.
| Compound Name | N-[4-(1-adamantyl)phenyl]-1-(1-ethyl-2,5-dimethylpyrrol-3-yl)methanimine |
|---|---|
| PubChem CID | 126103156 |
| Molecular Formula | C25H32N2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-1-(1-ethyl-2,5-dimethylpyrrol-3-yl)methanimine |
| SMILES | CCn1c(C)cc(/C=N/c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c1C |
| InChI | InChI=1S/C25H32N2/c1-4-27-17(2)9-22(18(27)3)16-26-24-7-5-23(6-8-24)25-13-19-10-20(14-25)12-21(11-19)15-25/h5-9,16,19-21H,4,10-15H2,1-3H3/b26-16+ |
| InChIKey | KRZXFLVPWACODD-WGOQTCKBSA-N |
| XLogP | 6.34 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|