C16H19FN2 — CID 126113111
1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(4-fluoro-3-methylphenyl)methanimine (PubChem CID 126113111) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(4-fluoro-3-methylphenyl)methanimine.
| Compound Name | 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(4-fluoro-3-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126113111 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(4-fluoro-3-methylphenyl)methanimine |
| SMILES | CCn1c(C)cc(/C=N/c2ccc(F)c(C)c2)c1C |
| InChI | InChI=1S/C16H19FN2/c1-5-19-12(3)9-14(13(19)4)10-18-15-6-7-16(17)11(2)8-15/h6-10H,5H2,1-4H3/b18-10+ |
| InChIKey | PBYANEOVJQMMRV-VCHYOVAHSA-N |
| XLogP | 4.32 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|