C15H17FN2 — CID 126071933
1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(2-fluorophenyl)methanimine (PubChem CID 126071933) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(2-fluorophenyl)methanimine.
| Compound Name | 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(2-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 126071933 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(2-fluorophenyl)methanimine |
| SMILES | CCn1c(C)cc(/C=N/c2ccccc2F)c1C |
| InChI | InChI=1S/C15H17FN2/c1-4-18-11(2)9-13(12(18)3)10-17-15-8-6-5-7-14(15)16/h5-10H,4H2,1-3H3/b17-10+ |
| InChIKey | JHRINQVKKUVVQP-LICLKQGHSA-N |
| XLogP | 4.01 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|