C15H18N2 — CID 126109555
1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-phenylmethanimine (PubChem CID 126109555) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-phenylmethanimine.
| Compound Name | 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-phenylmethanimine |
|---|---|
| PubChem CID | 126109555 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-phenylmethanimine |
| SMILES | CCn1c(C)cc(/C=N/c2ccccc2)c1C |
| InChI | InChI=1S/C15H18N2/c1-4-17-12(2)10-14(13(17)3)11-16-15-8-6-5-7-9-15/h5-11H,4H2,1-3H3/b16-11+ |
| InChIKey | XMNUJOIDIKAYPA-LFIBNONCSA-N |
| XLogP | 3.88 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|