C26H28INO4 — CID 23823805
2-[4-[[4-(1-adamantyl)phenyl]iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 23823805) has the molecular formula C26H28INO4 and a molecular weight of 545.42 g/mol. Its IUPAC name is 2-[4-[[4-(1-adamantyl)phenyl]iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[[4-(1-adamantyl)phenyl]iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 23823805 |
| Molecular Formula | C26H28INO4 |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 2-[4-[[4-(1-adamantyl)phenyl]iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=N/c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C26H28INO4/c1-31-23-10-19(9-22(27)25(23)32-15-24(29)30)14-28-21-4-2-20(3-5-21)26-11-16-6-17(12-26)8-18(7-16)13-26/h2-5,9-10,14,16-18H,6-8,11-13,15H2,1H3,(H,29,30)/b28-14+ |
| InChIKey | JXAHBDZIIMTZFP-CCVNUDIWSA-N |
| XLogP | 5.98 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|