C18H16INO6 — CID 23851912
4-[[4-(carboxymethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-3-methylbenzoic acid (PubChem CID 23851912) has the molecular formula C18H16INO6 and a molecular weight of 469.23 g/mol. Its IUPAC name is 4-[[4-(carboxymethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-3-methylbenzoic acid.
| Compound Name | 4-[[4-(carboxymethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 23851912 |
| Molecular Formula | C18H16INO6 |
| Molecular Weight | 469.23 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 4-[[4-(carboxymethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-3-methylbenzoic acid |
| SMILES | COc1cc(/C=N/c2ccc(C(=O)O)cc2C)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C18H16INO6/c1-10-5-12(18(23)24)3-4-14(10)20-8-11-6-13(19)17(15(7-11)25-2)26-9-16(21)22/h3-8H,9H2,1-2H3,(H,21,22)(H,23,24)/b20-8+ |
| InChIKey | JXFSNHZXWRDVJP-DNTJNYDQSA-N |
| XLogP | 3.52 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|