C20H22INO4 — CID 124583365
2-[4-[[4-[(2S)-butan-2-yl]phenyl]iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 124583365) has the molecular formula C20H22INO4 and a molecular weight of 467.30 g/mol. Its IUPAC name is 2-[4-[[4-[(2S)-butan-2-yl]phenyl]iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[[4-[(2S)-butan-2-yl]phenyl]iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 124583365 |
| Molecular Formula | C20H22INO4 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2-[4-[[4-[(2S)-butan-2-yl]phenyl]iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | CC[C@H](C)c1ccc(/N=C/c2cc(I)c(OCC(=O)O)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22INO4/c1-4-13(2)15-5-7-16(8-6-15)22-11-14-9-17(21)20(18(10-14)25-3)26-12-19(23)24/h5-11,13H,4,12H2,1-3H3,(H,23,24)/b22-11+/t13-/m0/s1 |
| InChIKey | IHISKFGFFPEGSQ-YSRRJJCPSA-N |
| XLogP | 5.03 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|