C20H25N5O2 — CID 137263766
5-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one (PubChem CID 137263766) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one.
| Compound Name | 5-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 137263766 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 5-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one |
| SMILES | Cc1ccc(-n2[nH]c(C)c(/C=N/C3CCC4NC(=O)NC4C3)c2=O)cc1C |
| InChI | InChI=1S/C20H25N5O2/c1-11-4-6-15(8-12(11)2)25-19(26)16(13(3)24-25)10-21-14-5-7-17-18(9-14)23-20(27)22-17/h4,6,8,10,14,17-18,24H,5,7,9H2,1-3H3,(H2,22,23,27)/b21-10+ |
| InChIKey | JDAVXOMENUXWAX-UFFVCSGVSA-N |
| XLogP | 2.11 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|