C21H21N3O2 — CID 135747434
4-(2,3-dihydro-1H-inden-2-yliminomethyl)-2-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-one (PubChem CID 135747434) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-2-yliminomethyl)-2-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-(2,3-dihydro-1H-inden-2-yliminomethyl)-2-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135747434 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-2-yliminomethyl)-2-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-one |
| SMILES | COc1ccc(-n2[nH]c(C)c(/C=N/C3Cc4ccccc4C3)c2=O)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-14-20(13-22-17-11-15-5-3-4-6-16(15)12-17)21(25)24(23-14)18-7-9-19(26-2)10-8-18/h3-10,13,17,23H,11-12H2,1-2H3/b22-13+ |
| InChIKey | PPHWKPYOHNLPIC-LPYMAVHISA-N |
| XLogP | 3.07 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|