C26H21N5O3 — CID 136624325
2-(4-methoxyphenyl)-3-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]quinazolin-4-one (PubChem CID 136624325) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(4-methoxyphenyl)-3-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 136624325 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-3-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]quinazolin-4-one |
| SMILES | COc1ccc(-c2nc3ccccc3c(=O)n2N=Cc2c(C)[nH]n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C26H21N5O3/c1-17-22(26(33)30(29-17)19-8-4-3-5-9-19)16-27-31-24(18-12-14-20(34-2)15-13-18)28-23-11-7-6-10-21(23)25(31)32/h3-16,29H,1-2H3 |
| InChIKey | SVWSNYFAWAVMHW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|