C22H22F3N3O3 — CID 136503925
N-[(E)-1-[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]ethylideneamino]-2-hydroxypropanamide (PubChem CID 136503925) has the molecular formula C22H22F3N3O3 and a molecular weight of 433.43 g/mol. Its IUPAC name is N-[(E)-1-[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]ethylideneamino]-2-hydroxypropanamide.
| Compound Name | N-[(E)-1-[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]ethylideneamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 136503925 |
| Molecular Formula | C22H22F3N3O3 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[(E)-1-[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]ethylideneamino]-2-hydroxypropanamide |
| SMILES | C/C(=N\NC(=O)C(C)O)c1c(O)n(-c2cc(C)cc(C)c2)c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C22H22F3N3O3/c1-11-7-12(2)9-16(8-11)28-18-10-15(22(23,24)25)5-6-17(18)19(21(28)31)13(3)26-27-20(30)14(4)29/h5-10,14,29,31H,1-4H3,(H,27,30)/b26-13+ |
| InChIKey | AGBSHVHOVNLWIV-LGJNPRDNSA-N |
| XLogP | 4.19 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|