C25H22N4O4 — CID 135929187
3-[[(E)-1-[2-hydroxy-1-(4-methylphenyl)indol-3-yl]ethylideneamino]carbamoylamino]benzoic acid (PubChem CID 135929187) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 3-[[(E)-1-[2-hydroxy-1-(4-methylphenyl)indol-3-yl]ethylideneamino]carbamoylamino]benzoic acid.
| Compound Name | 3-[[(E)-1-[2-hydroxy-1-(4-methylphenyl)indol-3-yl]ethylideneamino]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 135929187 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-[[(E)-1-[2-hydroxy-1-(4-methylphenyl)indol-3-yl]ethylideneamino]carbamoylamino]benzoic acid |
| SMILES | C/C(=N\NC(=O)Nc1cccc(C(=O)O)c1)c1c(O)n(-c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H22N4O4/c1-15-10-12-19(13-11-15)29-21-9-4-3-8-20(21)22(23(29)30)16(2)27-28-25(33)26-18-7-5-6-17(14-18)24(31)32/h3-14,30H,1-2H3,(H,31,32)(H2,26,28,33)/b27-16+ |
| InChIKey | ZDUPBJOBNUHOOD-JVWAILMASA-N |
| XLogP | 4.89 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|