C27H22F3N7O2 — CID 136503921
N-[(E)-[[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]-phenylmethylidene]amino]-2-(tetrazol-1-yl)acetamide (PubChem CID 136503921) has the molecular formula C27H22F3N7O2 and a molecular weight of 533.51 g/mol. Its IUPAC name is N-[(E)-[[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]-phenylmethylidene]amino]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[(E)-[[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]-phenylmethylidene]amino]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 136503921 |
| Molecular Formula | C27H22F3N7O2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | N-[(E)-[[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]-phenylmethylidene]amino]-2-(tetrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)cc(-n2c(O)c(/C(=N/NC(=O)Cn3cnnn3)c3ccccc3)c3ccc(C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C27H22F3N7O2/c1-16-10-17(2)12-20(11-16)37-22-13-19(27(28,29)30)8-9-21(22)24(26(37)39)25(18-6-4-3-5-7-18)33-32-23(38)14-36-15-31-34-35-36/h3-13,15,39H,14H2,1-2H3,(H,32,38)/b33-25+ |
| InChIKey | GKMBLZLLKOONBW-INKHBPHZSA-N |
| XLogP | 4.53 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|